C30H28FN5O6 — CID 78118569
N-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(4-fluorophenyl)-2,4-dioxo-1-propan-2-yl-1,3-diazinane-5-carboxamide (PubChem CID 78118569) has the molecular formula C30H28FN5O6 and a molecular weight of 573.58 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(4-fluorophenyl)-2,4-dioxo-1-propan-2-yl-1,3-diazinane-5-carboxamide.
| Compound Name | N-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(4-fluorophenyl)-2,4-dioxo-1-propan-2-yl-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 78118569 |
| Molecular Formula | C30H28FN5O6 |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | N-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(4-fluorophenyl)-2,4-dioxo-1-propan-2-yl-1,3-diazinane-5-carboxamide |
| SMILES | COc1cc2ncnc(Oc3ccc(NC(=O)C4CN(C(C)C)C(=O)N(c5ccc(F)cc5)C4=O)cc3)c2cc1OC |
| InChI | InChI=1S/C30H28FN5O6/c1-17(2)35-15-23(29(38)36(30(35)39)20-9-5-18(31)6-10-20)27(37)34-19-7-11-21(12-8-19)42-28-22-13-25(40-3)26(41-4)14-24(22)32-16-33-28/h5-14,16-17,23H,15H2,1-4H3,(H,34,37) |
| InChIKey | GAFVHZNDMVKKQZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|