C18H18FNO3S2 — CID 7812459
(4-methylsulfanylphenyl)methyl 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylacetate (PubChem CID 7812459) has the molecular formula C18H18FNO3S2 and a molecular weight of 379.48 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylacetate.
| Compound Name | (4-methylsulfanylphenyl)methyl 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 7812459 |
| Molecular Formula | C18H18FNO3S2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | (4-methylsulfanylphenyl)methyl 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylacetate |
| SMILES | CSc1ccc(COC(=O)CSCC(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H18FNO3S2/c1-24-16-8-2-13(3-9-16)10-23-18(22)12-25-11-17(21)20-15-6-4-14(19)5-7-15/h2-9H,10-12H2,1H3,(H,20,21) |
| InChIKey | BQCAVPMEMAGMBE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |