C21H22F3NO5S — CID 1300210
(4-propylsulfonylphenyl)methyl 4-oxo-4-[2-(trifluoromethyl)anilino]butanoate (PubChem CID 1300210) has the molecular formula C21H22F3NO5S and a molecular weight of 457.47 g/mol. Its IUPAC name is (4-propylsulfonylphenyl)methyl 4-oxo-4-[2-(trifluoromethyl)anilino]butanoate.
| Compound Name | (4-propylsulfonylphenyl)methyl 4-oxo-4-[2-(trifluoromethyl)anilino]butanoate |
|---|---|
| PubChem CID | 1300210 |
| Molecular Formula | C21H22F3NO5S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | (4-propylsulfonylphenyl)methyl 4-oxo-4-[2-(trifluoromethyl)anilino]butanoate |
| SMILES | CCCS(=O)(=O)c1ccc(COC(=O)CCC(=O)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3NO5S/c1-2-13-31(28,29)16-9-7-15(8-10-16)14-30-20(27)12-11-19(26)25-18-6-4-3-5-17(18)21(22,23)24/h3-10H,2,11-14H2,1H3,(H,25,26) |
| InChIKey | BMGGGKMTSOCNFB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |