C15H10BrNO3S — CID 7814672
[2-(3-bromophenyl)-1,3-thiazol-4-yl]methyl furan-2-carboxylate (PubChem CID 7814672) has the molecular formula C15H10BrNO3S and a molecular weight of 364.22 g/mol. Its IUPAC name is [2-(3-bromophenyl)-1,3-thiazol-4-yl]methyl furan-2-carboxylate.
| Compound Name | [2-(3-bromophenyl)-1,3-thiazol-4-yl]methyl furan-2-carboxylate |
|---|---|
| PubChem CID | 7814672 |
| Molecular Formula | C15H10BrNO3S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | [2-(3-bromophenyl)-1,3-thiazol-4-yl]methyl furan-2-carboxylate |
| SMILES | O=C(OCc1csc(-c2cccc(Br)c2)n1)c1ccco1 |
| InChI | InChI=1S/C15H10BrNO3S/c16-11-4-1-3-10(7-11)14-17-12(9-21-14)8-20-15(18)13-5-2-6-19-13/h1-7,9H,8H2 |
| InChIKey | KKUQUGKMTPPDMA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |