C27H18Cl2F5NO3 — CID 78147799
benzyl 3-[4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]phenyl]-3-fluoroazetidine-1-carboxylate (PubChem CID 78147799) has the molecular formula C27H18Cl2F5NO3 and a molecular weight of 570.34 g/mol. Its IUPAC name is benzyl 3-[4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]phenyl]-3-fluoroazetidine-1-carboxylate.
| Compound Name | benzyl 3-[4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]phenyl]-3-fluoroazetidine-1-carboxylate |
|---|---|
| PubChem CID | 78147799 |
| Molecular Formula | C27H18Cl2F5NO3 |
| Molecular Weight | 570.34 g/mol |
| Exact Mass | 569.06 |
| IUPAC Name | benzyl 3-[4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]phenyl]-3-fluoroazetidine-1-carboxylate |
| SMILES | O=C(C=C(c1cc(Cl)c(F)c(Cl)c1)C(F)(F)F)c1ccc(C2(F)CN(C(=O)OCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C27H18Cl2F5NO3/c28-21-10-18(11-22(29)24(21)30)20(27(32,33)34)12-23(36)17-6-8-19(9-7-17)26(31)14-35(15-26)25(37)38-13-16-4-2-1-3-5-16/h1-12H,13-15H2 |
| InChIKey | JLCHMMUKSUKJMX-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.34 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|