C16H29NO3 — CID 78150880
4-cyclohexyl-3-(oxan-4-ylamino)cyclopentane-1,2-diol (PubChem CID 78150880) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is 4-cyclohexyl-3-(oxan-4-ylamino)cyclopentane-1,2-diol.
| Compound Name | 4-cyclohexyl-3-(oxan-4-ylamino)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 78150880 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 4-cyclohexyl-3-(oxan-4-ylamino)cyclopentane-1,2-diol |
| SMILES | OC1CC(C2CCCCC2)C(NC2CCOCC2)C1O |
| InChI | InChI=1S/C16H29NO3/c18-14-10-13(11-4-2-1-3-5-11)15(16(14)19)17-12-6-8-20-9-7-12/h11-19H,1-10H2 |
| InChIKey | ABAPZVVYWLHUCX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |