C17H16BrF2NOS — CID 78152888
2-bromo-2,2-difluoro-N-(1-phenyl-3-phenylsulfanylpropan-2-yl)acetamide (PubChem CID 78152888) has the molecular formula C17H16BrF2NOS and a molecular weight of 400.29 g/mol. Its IUPAC name is 2-bromo-2,2-difluoro-N-(1-phenyl-3-phenylsulfanylpropan-2-yl)acetamide.
| Compound Name | 2-bromo-2,2-difluoro-N-(1-phenyl-3-phenylsulfanylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 78152888 |
| Molecular Formula | C17H16BrF2NOS |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 2-bromo-2,2-difluoro-N-(1-phenyl-3-phenylsulfanylpropan-2-yl)acetamide |
| SMILES | O=C(NC(CSc1ccccc1)Cc1ccccc1)C(F)(F)Br |
| InChI | InChI=1S/C17H16BrF2NOS/c18-17(19,20)16(22)21-14(11-13-7-3-1-4-8-13)12-23-15-9-5-2-6-10-15/h1-10,14H,11-12H2,(H,21,22) |
| InChIKey | JJRTVPSYNPIYFW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|