C21H33N3O5 — CID 78155079
but-2-enedioic acid;N-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butyl]cyclohexanamine (PubChem CID 78155079) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is but-2-enedioic acid;N-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butyl]cyclohexanamine.
| Compound Name | but-2-enedioic acid;N-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butyl]cyclohexanamine |
|---|---|
| PubChem CID | 78155079 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | but-2-enedioic acid;N-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butyl]cyclohexanamine |
| SMILES | O=C(O)C=CC(=O)O.c1c(OCCCCNC2CCCCC2)nn2c1CCCC2 |
| InChI | InChI=1S/C17H29N3O.C4H4O4/c1-2-8-15(9-3-1)18-11-5-7-13-21-17-14-16-10-4-6-12-20(16)19-17;5-3(6)1-2-4(7)8/h14-15,18H,1-13H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | PQDBDCGRAJKGPS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|