C25H37N3O5 — CID 134607217
(Z)-but-2-enedioic acid;N-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butyl]adamantan-2-amine (PubChem CID 134607217) has the molecular formula C25H37N3O5 and a molecular weight of 459.59 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butyl]adamantan-2-amine.
| Compound Name | (Z)-but-2-enedioic acid;N-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butyl]adamantan-2-amine |
|---|---|
| PubChem CID | 134607217 |
| Molecular Formula | C25H37N3O5 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butyl]adamantan-2-amine |
| SMILES | O=C(O)/C=C\C(=O)O.c1c(OCCCCNC2C3CC4CC(C3)CC2C4)nn2c1CCCC2 |
| InChI | InChI=1S/C21H33N3O.C4H4O4/c1-3-7-24-19(5-1)14-20(23-24)25-8-4-2-6-22-21-17-10-15-9-16(12-17)13-18(21)11-15;5-3(6)1-2-4(7)8/h14-18,21-22H,1-13H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | SCPDRXATNSNZKA-BTJKTKAUSA-N |
| XLogP | 3.50 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|