C20H31N3O6 — CID 71711523
(Z)-but-2-enedioic acid;4-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butyl]-1,4-oxazepane (PubChem CID 71711523) has the molecular formula C20H31N3O6 and a molecular weight of 409.48 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;4-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butyl]-1,4-oxazepane.
| Compound Name | (Z)-but-2-enedioic acid;4-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 71711523 |
| Molecular Formula | C20H31N3O6 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | (Z)-but-2-enedioic acid;4-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butyl]-1,4-oxazepane |
| SMILES | O=C(O)/C=C\C(=O)O.c1c(OCCCCN2CCCOCC2)nn2c1CCCC2 |
| InChI | InChI=1S/C16H27N3O2.C4H4O4/c1-2-9-19-15(6-1)14-16(17-19)21-12-4-3-7-18-8-5-11-20-13-10-18;5-3(6)1-2-4(7)8/h14H,1-13H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | UBILSUQHGKHYGG-BTJKTKAUSA-N |
| XLogP | 1.81 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|