C21H35N3O5 — CID 157397448
2-[4-(azepan-1-yl)butoxy]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine;1-hydroperoxyperoxybut-2-yne (PubChem CID 157397448) has the molecular formula C21H35N3O5 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[4-(azepan-1-yl)butoxy]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine;1-hydroperoxyperoxybut-2-yne.
| Compound Name | 2-[4-(azepan-1-yl)butoxy]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine;1-hydroperoxyperoxybut-2-yne |
|---|---|
| PubChem CID | 157397448 |
| Molecular Formula | C21H35N3O5 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 2-[4-(azepan-1-yl)butoxy]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine;1-hydroperoxyperoxybut-2-yne |
| SMILES | CC#CCOOOO.c1c(OCCCCN2CCCCCC2)nn2c1CCCC2 |
| InChI | InChI=1S/C17H29N3O.C4H6O4/c1-2-5-11-19(10-4-1)12-7-8-14-21-17-15-16-9-3-6-13-20(16)18-17;1-2-3-4-6-8-7-5/h15H,1-14H2;5H,4H2,1H3 |
| InChIKey | BMSXQXMFVJUNHL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|