C22H27N3O5S — CID 158770845
1-hydroperoxyperoxybut-2-yne;2-phenyl-6-(2-pyrrolidin-1-ylethoxymethyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 158770845) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-hydroperoxyperoxybut-2-yne;2-phenyl-6-(2-pyrrolidin-1-ylethoxymethyl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 1-hydroperoxyperoxybut-2-yne;2-phenyl-6-(2-pyrrolidin-1-ylethoxymethyl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 158770845 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-hydroperoxyperoxybut-2-yne;2-phenyl-6-(2-pyrrolidin-1-ylethoxymethyl)imidazo[2,1-b][1,3]thiazole |
| SMILES | CC#CCOOOO.c1ccc(-c2cn3cc(COCCN4CCCC4)nc3s2)cc1 |
| InChI | InChI=1S/C18H21N3OS.C4H6O4/c1-2-6-15(7-3-1)17-13-21-12-16(19-18(21)23-17)14-22-11-10-20-8-4-5-9-20;1-2-3-4-6-8-7-5/h1-3,6-7,12-13H,4-5,8-11,14H2;5H,4H2,1H3 |
| InChIKey | IPVPGZRBIRJATP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|