C21H32N4O5 — CID 160903552
1-hydroperoxyperoxybut-2-yne;2-[4-(4-methylpiperazin-1-yl)butoxymethyl]pyrazolo[1,5-a]pyridine (PubChem CID 160903552) has the molecular formula C21H32N4O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1-hydroperoxyperoxybut-2-yne;2-[4-(4-methylpiperazin-1-yl)butoxymethyl]pyrazolo[1,5-a]pyridine.
| Compound Name | 1-hydroperoxyperoxybut-2-yne;2-[4-(4-methylpiperazin-1-yl)butoxymethyl]pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 160903552 |
| Molecular Formula | C21H32N4O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 1-hydroperoxyperoxybut-2-yne;2-[4-(4-methylpiperazin-1-yl)butoxymethyl]pyrazolo[1,5-a]pyridine |
| SMILES | CC#CCOOOO.CN1CCN(CCCCOCc2cc3ccccn3n2)CC1 |
| InChI | InChI=1S/C17H26N4O.C4H6O4/c1-19-9-11-20(12-10-19)7-4-5-13-22-15-16-14-17-6-2-3-8-21(17)18-16;1-2-3-4-6-8-7-5/h2-3,6,8,14H,4-5,7,9-13,15H2,1H3;5H,4H2,1H3 |
| InChIKey | SPVFJPJRGHRTMY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|