C25H39N3O5 — CID 159617536
2-[4-(4-tert-butylpiperidin-1-yl)butoxymethyl]pyrazolo[1,5-a]pyridine;1-hydroperoxyperoxybut-2-yne (PubChem CID 159617536) has the molecular formula C25H39N3O5 and a molecular weight of 461.60 g/mol. Its IUPAC name is 2-[4-(4-tert-butylpiperidin-1-yl)butoxymethyl]pyrazolo[1,5-a]pyridine;1-hydroperoxyperoxybut-2-yne.
| Compound Name | 2-[4-(4-tert-butylpiperidin-1-yl)butoxymethyl]pyrazolo[1,5-a]pyridine;1-hydroperoxyperoxybut-2-yne |
|---|---|
| PubChem CID | 159617536 |
| Molecular Formula | C25H39N3O5 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | 2-[4-(4-tert-butylpiperidin-1-yl)butoxymethyl]pyrazolo[1,5-a]pyridine;1-hydroperoxyperoxybut-2-yne |
| SMILES | CC#CCOOOO.CC(C)(C)C1CCN(CCCCOCc2cc3ccccn3n2)CC1 |
| InChI | InChI=1S/C21H33N3O.C4H6O4/c1-21(2,3)18-9-13-23(14-10-18)11-6-7-15-25-17-19-16-20-8-4-5-12-24(20)22-19;1-2-3-4-6-8-7-5/h4-5,8,12,16,18H,6-7,9-11,13-15,17H2,1-3H3;5H,4H2,1H3 |
| InChIKey | MNLWUWUVGROEDZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 77.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|