C23H29N3O5 — CID 140665148
2-(1-adamantyl)-5-[2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)ethyl]-1,3,2-dioxazepine-4,7-dione (PubChem CID 140665148) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-(1-adamantyl)-5-[2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)ethyl]-1,3,2-dioxazepine-4,7-dione.
| Compound Name | 2-(1-adamantyl)-5-[2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)ethyl]-1,3,2-dioxazepine-4,7-dione |
|---|---|
| PubChem CID | 140665148 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-(1-adamantyl)-5-[2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)ethyl]-1,3,2-dioxazepine-4,7-dione |
| SMILES | O=C1C=C(CCOc2cc3n(n2)CCCC3)C(=O)ON(C23CC4CC(CC(C4)C2)C3)O1 |
| InChI | InChI=1S/C23H29N3O5/c27-21-10-18(4-6-29-20-11-19-3-1-2-5-25(19)24-20)22(28)31-26(30-21)23-12-15-7-16(13-23)9-17(8-15)14-23/h10-11,15-17H,1-9,12-14H2 |
| InChIKey | MRSIAXLUGSWICX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |