C10H16N5O3+ — CID 78168861
8-(2-hydroxyethylamino)-1,3,7-trimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 78168861) has the molecular formula C10H16N5O3+ and a molecular weight of 254.27 g/mol. Its IUPAC name is 8-(2-hydroxyethylamino)-1,3,7-trimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-(2-hydroxyethylamino)-1,3,7-trimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78168861 |
| Molecular Formula | C10H16N5O3+ |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 8-(2-hydroxyethylamino)-1,3,7-trimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(NCCO)=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C10H15N5O3/c1-13-6-7(12-9(13)11-4-5-16)14(2)10(18)15(3)8(6)17/h6,16H,4-5H2,1-3H3/p+1 |
| InChIKey | URQMAPMUKLNCIT-UHFFFAOYSA-O |
| XLogP | -2.13 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|