C14H22N5O4+ — CID 78201785
7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-pyrrolidin-1-ium-1-ylidene-5H-purine-2,6-dione (PubChem CID 78201785) has the molecular formula C14H22N5O4+ and a molecular weight of 324.36 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-pyrrolidin-1-ium-1-ylidene-5H-purine-2,6-dione.
| Compound Name | 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-pyrrolidin-1-ium-1-ylidene-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 78201785 |
| Molecular Formula | C14H22N5O4+ |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-pyrrolidin-1-ium-1-ylidene-5H-purine-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(=[N+]3CCCC3)N2CC(O)CO)N(C)C1=O |
| InChI | InChI=1S/C14H22N5O4/c1-16-11-10(12(22)17(2)14(16)23)19(7-9(21)8-20)13(15-11)18-5-3-4-6-18/h9-10,20-21H,3-8H2,1-2H3/q+1 |
| InChIKey | KIBQWDHJVWCRKT-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|