C9H12N5O3+ — CID 78202292
2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetamide (PubChem CID 78202292) has the molecular formula C9H12N5O3+ and a molecular weight of 238.23 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetamide |
|---|---|
| PubChem CID | 78202292 |
| Molecular Formula | C9H12N5O3+ |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetamide |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CC(N)=O)N(C)C1=O |
| InChI | InChI=1S/C9H11N5O3/c1-12-7-6(8(16)13(2)9(12)17)14(4-11-7)3-5(10)15/h4,6H,3H2,1-2H3,(H-,10,15)/p+1 |
| InChIKey | DXHYIAPNELVSRL-UHFFFAOYSA-O |
| XLogP | -2.18 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|