C14H22N6O3 — CID 78203643
2-[8-(azepan-1-yl)-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl]acetamide (PubChem CID 78203643) has the molecular formula C14H22N6O3 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-[8-(azepan-1-yl)-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl]acetamide.
| Compound Name | 2-[8-(azepan-1-yl)-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl]acetamide |
|---|---|
| PubChem CID | 78203643 |
| Molecular Formula | C14H22N6O3 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-[8-(azepan-1-yl)-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl]acetamide |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(N1CCCCCC1)N2CC(N)=O |
| InChI | InChI=1S/C14H22N6O3/c1-18-11-10(12(22)17-14(18)23)20(8-9(15)21)13(16-11)19-6-4-2-3-5-7-19/h10-11H,2-8H2,1H3,(H2,15,21)(H,17,22,23) |
| InChIKey | SVWODZIRKPXZJV-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |