C18H20N2OS2 — CID 78204427
3-benzyl-7-methyl-2-sulfanylidene-4a,5,6,7,8,9a-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 78204427) has the molecular formula C18H20N2OS2 and a molecular weight of 344.51 g/mol. Its IUPAC name is 3-benzyl-7-methyl-2-sulfanylidene-4a,5,6,7,8,9a-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-benzyl-7-methyl-2-sulfanylidene-4a,5,6,7,8,9a-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 78204427 |
| Molecular Formula | C18H20N2OS2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 3-benzyl-7-methyl-2-sulfanylidene-4a,5,6,7,8,9a-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC1CCC2=C(C1)SC1NC(=S)N(Cc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C18H20N2OS2/c1-11-7-8-13-14(9-11)23-16-15(13)17(21)20(18(22)19-16)10-12-5-3-2-4-6-12/h2-6,11,15-16H,7-10H2,1H3,(H,19,22) |
| InChIKey | ZICCVEYEFANKJI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|