C9H14N4O4 — CID 78209610
7-(2,3-dihydroxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 78209610) has the molecular formula C9H14N4O4 and a molecular weight of 242.24 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-(2,3-dihydroxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78209610 |
| Molecular Formula | C9H14N4O4 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=CN2CC(O)CO |
| InChI | InChI=1S/C9H14N4O4/c1-12-7-6(8(16)11-9(12)17)13(4-10-7)2-5(15)3-14/h4-7,14-15H,2-3H2,1H3,(H,11,16,17) |
| InChIKey | KFHKGDREPHJZLF-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |