C18H21N6O2+ — CID 78215135
8-(4-benzylpiperazin-1-ium-1-ylidene)-1,3-dimethylpurine-2,6-dione (PubChem CID 78215135) has the molecular formula C18H21N6O2+ and a molecular weight of 353.41 g/mol. Its IUPAC name is 8-(4-benzylpiperazin-1-ium-1-ylidene)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-(4-benzylpiperazin-1-ium-1-ylidene)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 78215135 |
| Molecular Formula | C18H21N6O2+ |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 8-(4-benzylpiperazin-1-ium-1-ylidene)-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=NC(=[N+]1CCN(Cc3ccccc3)CC1)N=2 |
| InChI | InChI=1S/C18H21N6O2/c1-21-15-14(16(25)22(2)18(21)26)19-17(20-15)24-10-8-23(9-11-24)12-13-6-4-3-5-7-13/h3-7H,8-12H2,1-2H3/q+1 |
| InChIKey | SLULJCMRBQXZQU-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|