C24H24ClNO5 — CID 78222463
2-[[3-(4-chlorophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]-N-(4-methoxyphenyl)acetamide (PubChem CID 78222463) has the molecular formula C24H24ClNO5 and a molecular weight of 441.91 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[[3-(4-chlorophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 78222463 |
| Molecular Formula | C24H24ClNO5 |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COC2CCC3C(=O)C(c4ccc(Cl)cc4)=COC3C2)cc1 |
| InChI | InChI=1S/C24H24ClNO5/c1-29-18-8-6-17(7-9-18)26-23(27)14-30-19-10-11-20-22(12-19)31-13-21(24(20)28)15-2-4-16(25)5-3-15/h2-9,13,19-20,22H,10-12,14H2,1H3,(H,26,27) |
| InChIKey | PPYWMNZXPDFJKV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |