C27H31NO5 — CID 73262677
N-(3,5-dimethylphenyl)-2-[[3-(4-methoxyphenyl)-8-methyl-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetamide (PubChem CID 73262677) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[[3-(4-methoxyphenyl)-8-methyl-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[[3-(4-methoxyphenyl)-8-methyl-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetamide |
|---|---|
| PubChem CID | 73262677 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[[3-(4-methoxyphenyl)-8-methyl-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetamide |
| SMILES | COc1ccc(C2=COC3C(CCC(OCC(=O)Nc4cc(C)cc(C)c4)C3C)C2=O)cc1 |
| InChI | InChI=1S/C27H31NO5/c1-16-11-17(2)13-20(12-16)28-25(29)15-32-24-10-9-22-26(30)23(14-33-27(22)18(24)3)19-5-7-21(31-4)8-6-19/h5-8,11-14,18,22,24,27H,9-10,15H2,1-4H3,(H,28,29) |
| InChIKey | YGDYITWLBNKKDL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |