C23H25NO4 — CID 78371999
7-(4-methoxyanilino)-3-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 78371999) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 7-(4-methoxyanilino)-3-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 7-(4-methoxyanilino)-3-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 78371999 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 7-(4-methoxyanilino)-3-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | COc1ccc(NC2CCC3C(=O)C(c4ccc(OC)cc4)=COC3C2)cc1 |
| InChI | InChI=1S/C23H25NO4/c1-26-18-8-3-15(4-9-18)21-14-28-22-13-17(7-12-20(22)23(21)25)24-16-5-10-19(27-2)11-6-16/h3-6,8-11,14,17,20,22,24H,7,12-13H2,1-2H3 |
| InChIKey | NOEAGDRWOHHLII-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|