C21H27NO5 — CID 73402401
9-(2-methoxyethyl)-3-(4-methoxyphenyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one (PubChem CID 73402401) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 9-(2-methoxyethyl)-3-(4-methoxyphenyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one.
| Compound Name | 9-(2-methoxyethyl)-3-(4-methoxyphenyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 73402401 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 9-(2-methoxyethyl)-3-(4-methoxyphenyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
| SMILES | COCCN1COC2CCC3C(=O)C(c4ccc(OC)cc4)=COC3C2C1 |
| InChI | InChI=1S/C21H27NO5/c1-24-10-9-22-11-17-19(27-13-22)8-7-16-20(23)18(12-26-21(16)17)14-3-5-15(25-2)6-4-14/h3-6,12,16-17,19,21H,7-11,13H2,1-2H3 |
| InChIKey | SPILPABOAKMMAA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |