C27H38N2O4 — CID 73402898
3-(4-methoxyphenyl)-9-(2,2,6,6-tetramethylpiperidin-4-yl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one (PubChem CID 73402898) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-9-(2,2,6,6-tetramethylpiperidin-4-yl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one.
| Compound Name | 3-(4-methoxyphenyl)-9-(2,2,6,6-tetramethylpiperidin-4-yl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 73402898 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | 3-(4-methoxyphenyl)-9-(2,2,6,6-tetramethylpiperidin-4-yl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
| SMILES | COc1ccc(C2=COC3C(CCC4OCN(C5CC(C)(C)NC(C)(C)C5)CC43)C2=O)cc1 |
| InChI | InChI=1S/C27H38N2O4/c1-26(2)12-18(13-27(3,4)28-26)29-14-21-23(33-16-29)11-10-20-24(30)22(15-32-25(20)21)17-6-8-19(31-5)9-7-17/h6-9,15,18,20-21,23,25,28H,10-14,16H2,1-5H3 |
| InChIKey | BVWGLKQLJVAHHR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |