C26H28ClNO5 — CID 73259753
3-(4-chlorophenyl)-9-[(3,4-dimethoxyphenyl)methyl]-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one (PubChem CID 73259753) has the molecular formula C26H28ClNO5 and a molecular weight of 469.97 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-9-[(3,4-dimethoxyphenyl)methyl]-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one.
| Compound Name | 3-(4-chlorophenyl)-9-[(3,4-dimethoxyphenyl)methyl]-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 73259753 |
| Molecular Formula | C26H28ClNO5 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 3-(4-chlorophenyl)-9-[(3,4-dimethoxyphenyl)methyl]-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
| SMILES | COc1ccc(CN2COC3CCC4C(=O)C(c5ccc(Cl)cc5)=COC4C3C2)cc1OC |
| InChI | InChI=1S/C26H28ClNO5/c1-30-23-9-3-16(11-24(23)31-2)12-28-13-20-22(33-15-28)10-8-19-25(29)21(14-32-26(19)20)17-4-6-18(27)7-5-17/h3-7,9,11,14,19-20,22,26H,8,10,12-13,15H2,1-2H3 |
| InChIKey | CPCXKEPMQUCITI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |