C24H24FNO4 — CID 73257343
9-(4-fluorophenyl)-3-(2-methoxyphenyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one (PubChem CID 73257343) has the molecular formula C24H24FNO4 and a molecular weight of 409.46 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-3-(2-methoxyphenyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one.
| Compound Name | 9-(4-fluorophenyl)-3-(2-methoxyphenyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 73257343 |
| Molecular Formula | C24H24FNO4 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 9-(4-fluorophenyl)-3-(2-methoxyphenyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
| SMILES | COc1ccccc1C1=COC2C(CCC3OCN(c4ccc(F)cc4)CC32)C1=O |
| InChI | InChI=1S/C24H24FNO4/c1-28-21-5-3-2-4-17(21)20-13-29-24-18(23(20)27)10-11-22-19(24)12-26(14-30-22)16-8-6-15(25)7-9-16/h2-9,13,18-19,22,24H,10-12,14H2,1H3 |
| InChIKey | RXUGRVPVADELBZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |