C24H30O6 — CID 78222004
cyclohexyl 2-[[3-(2-methoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate (PubChem CID 78222004) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is cyclohexyl 2-[[3-(2-methoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate.
| Compound Name | cyclohexyl 2-[[3-(2-methoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 78222004 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | cyclohexyl 2-[[3-(2-methoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate |
| SMILES | COc1ccccc1C1=COC2CC(OCC(=O)OC3CCCCC3)CCC2C1=O |
| InChI | InChI=1S/C24H30O6/c1-27-21-10-6-5-9-18(21)20-14-29-22-13-17(11-12-19(22)24(20)26)28-15-23(25)30-16-7-3-2-4-8-16/h5-6,9-10,14,16-17,19,22H,2-4,7-8,11-13,15H2,1H3 |
| InChIKey | ZYOQBUXCHWEAOK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |