C22H22O6S — CID 78236551
[3-(3,4-dimethoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] thiophene-2-carboxylate (PubChem CID 78236551) has the molecular formula C22H22O6S and a molecular weight of 414.48 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] thiophene-2-carboxylate.
| Compound Name | [3-(3,4-dimethoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 78236551 |
| Molecular Formula | C22H22O6S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] thiophene-2-carboxylate |
| SMILES | COc1ccc(C2=COC3CC(OC(=O)c4cccs4)CCC3C2=O)cc1OC |
| InChI | InChI=1S/C22H22O6S/c1-25-17-8-5-13(10-19(17)26-2)16-12-27-18-11-14(6-7-15(18)21(16)23)28-22(24)20-4-3-9-29-20/h3-5,8-10,12,14-15,18H,6-7,11H2,1-2H3 |
| InChIKey | SCENSWFOSOMUDD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |