C22H21ClO5S — CID 78222389
[3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] thiophene-2-carboxylate (PubChem CID 78222389) has the molecular formula C22H21ClO5S and a molecular weight of 432.93 g/mol. Its IUPAC name is [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] thiophene-2-carboxylate.
| Compound Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 78222389 |
| Molecular Formula | C22H21ClO5S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] thiophene-2-carboxylate |
| SMILES | Cc1cc(OC2=COC3CC(OC(=O)c4cccs4)CCC3C2=O)cc(C)c1Cl |
| InChI | InChI=1S/C22H21ClO5S/c1-12-8-15(9-13(2)20(12)23)27-18-11-26-17-10-14(5-6-16(17)21(18)24)28-22(25)19-4-3-7-29-19/h3-4,7-9,11,14,16-17H,5-6,10H2,1-2H3 |
| InChIKey | ZWUHYTMQNDRCAK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |