C22H26O6 — CID 78293244
[3-(3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] oxolane-2-carboxylate (PubChem CID 78293244) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is [3-(3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] oxolane-2-carboxylate.
| Compound Name | [3-(3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] oxolane-2-carboxylate |
|---|---|
| PubChem CID | 78293244 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [3-(3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] oxolane-2-carboxylate |
| SMILES | Cc1cc(C)cc(OC2=COC3CC(OC(=O)C4CCCO4)CCC3C2=O)c1 |
| InChI | InChI=1S/C22H26O6/c1-13-8-14(2)10-16(9-13)27-20-12-26-19-11-15(5-6-17(19)21(20)23)28-22(24)18-4-3-7-25-18/h8-10,12,15,17-19H,3-7,11H2,1-2H3 |
| InChIKey | KVDAUZVXHPNTKW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |