C26H28O6 — CID 78222558
methyl 4-[[3-(3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxymethyl]benzoate (PubChem CID 78222558) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is methyl 4-[[3-(3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[3-(3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 78222558 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | methyl 4-[[3-(3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COC2CCC3C(=O)C(Oc4cc(C)cc(C)c4)=COC3C2)cc1 |
| InChI | InChI=1S/C26H28O6/c1-16-10-17(2)12-21(11-16)32-24-15-31-23-13-20(8-9-22(23)25(24)27)30-14-18-4-6-19(7-5-18)26(28)29-3/h4-7,10-12,15,20,22-23H,8-9,13-14H2,1-3H3 |
| InChIKey | OBZKOBMBGYDRCW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |