C23H32O4 — CID 78237826
3-(4-ethylphenoxy)-7-hexoxy-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 78237826) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 3-(4-ethylphenoxy)-7-hexoxy-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 3-(4-ethylphenoxy)-7-hexoxy-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 78237826 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 3-(4-ethylphenoxy)-7-hexoxy-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | CCCCCCOC1CCC2C(=O)C(Oc3ccc(CC)cc3)=COC2C1 |
| InChI | InChI=1S/C23H32O4/c1-3-5-6-7-14-25-19-12-13-20-21(15-19)26-16-22(23(20)24)27-18-10-8-17(4-2)9-11-18/h8-11,16,19-21H,3-7,12-15H2,1-2H3 |
| InChIKey | JDJAREZUJZGPAF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|