C23H31ClO4 — CID 78237837
3-(4-chloro-3,5-dimethylphenoxy)-7-hexoxy-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 78237837) has the molecular formula C23H31ClO4 and a molecular weight of 406.95 g/mol. Its IUPAC name is 3-(4-chloro-3,5-dimethylphenoxy)-7-hexoxy-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 3-(4-chloro-3,5-dimethylphenoxy)-7-hexoxy-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 78237837 |
| Molecular Formula | C23H31ClO4 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 3-(4-chloro-3,5-dimethylphenoxy)-7-hexoxy-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | CCCCCCOC1CCC2C(=O)C(Oc3cc(C)c(Cl)c(C)c3)=COC2C1 |
| InChI | InChI=1S/C23H31ClO4/c1-4-5-6-7-10-26-17-8-9-19-20(13-17)27-14-21(23(19)25)28-18-11-15(2)22(24)16(3)12-18/h11-12,14,17,19-20H,4-10,13H2,1-3H3 |
| InChIKey | MEOSIFNLFWMVTR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|