C23H30O7 — CID 78237790
2-ethoxyethyl 2-[[3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate (PubChem CID 78237790) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[[3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate.
| Compound Name | 2-ethoxyethyl 2-[[3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 78237790 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-ethoxyethyl 2-[[3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate |
| SMILES | CCOCCOC(=O)COC1CCC2C(=O)C(Oc3cc(C)ccc3C)=COC2C1 |
| InChI | InChI=1S/C23H30O7/c1-4-26-9-10-27-22(24)14-28-17-7-8-18-20(12-17)29-13-21(23(18)25)30-19-11-15(2)5-6-16(19)3/h5-6,11,13,17-18,20H,4,7-10,12,14H2,1-3H3 |
| InChIKey | WQMYAXKTMJBYDG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|