C21H26O5 — CID 78222253
[3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 2-methylpropanoate (PubChem CID 78222253) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is [3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 2-methylpropanoate.
| Compound Name | [3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 78222253 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 2-methylpropanoate |
| SMILES | Cc1ccc(C)c(OC2=COC3CC(OC(=O)C(C)C)CCC3C2=O)c1 |
| InChI | InChI=1S/C21H26O5/c1-12(2)21(23)25-15-7-8-16-18(10-15)24-11-19(20(16)22)26-17-9-13(3)5-6-14(17)4/h5-6,9,11-12,15-16,18H,7-8,10H2,1-4H3 |
| InChIKey | MMEPVOYOYMJMJU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |