C25H28O4 — CID 78222572
3-(2,5-dimethylphenoxy)-7-[(2-methylphenyl)methoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 78222572) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-(2,5-dimethylphenoxy)-7-[(2-methylphenyl)methoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 3-(2,5-dimethylphenoxy)-7-[(2-methylphenyl)methoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 78222572 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 3-(2,5-dimethylphenoxy)-7-[(2-methylphenyl)methoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | Cc1ccc(C)c(OC2=COC3CC(OCc4ccccc4C)CCC3C2=O)c1 |
| InChI | InChI=1S/C25H28O4/c1-16-8-9-18(3)22(12-16)29-24-15-28-23-13-20(10-11-21(23)25(24)26)27-14-19-7-5-4-6-17(19)2/h4-9,12,15,20-21,23H,10-11,13-14H2,1-3H3 |
| InChIKey | YKSKJBMBXDNCQT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |