C26H28O6 — CID 78222278
benzyl 2-[[3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate (PubChem CID 78222278) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is benzyl 2-[[3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate.
| Compound Name | benzyl 2-[[3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 78222278 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | benzyl 2-[[3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate |
| SMILES | Cc1ccc(C)c(OC2=COC3CC(OCC(=O)OCc4ccccc4)CCC3C2=O)c1 |
| InChI | InChI=1S/C26H28O6/c1-17-8-9-18(2)22(12-17)32-24-15-30-23-13-20(10-11-21(23)26(24)28)29-16-25(27)31-14-19-6-4-3-5-7-19/h3-9,12,15,20-21,23H,10-11,13-14,16H2,1-2H3 |
| InChIKey | VSAFPGZXKFXFEI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |