C21H26O7 — CID 78246462
ethyl 2-[[3-(3,4-dimethoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate (PubChem CID 78246462) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is ethyl 2-[[3-(3,4-dimethoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate.
| Compound Name | ethyl 2-[[3-(3,4-dimethoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 78246462 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | ethyl 2-[[3-(3,4-dimethoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetate |
| SMILES | CCOC(=O)COC1CCC2C(=O)C(c3ccc(OC)c(OC)c3)=COC2C1 |
| InChI | InChI=1S/C21H26O7/c1-4-26-20(22)12-27-14-6-7-15-18(10-14)28-11-16(21(15)23)13-5-8-17(24-2)19(9-13)25-3/h5,8-9,11,14-15,18H,4,6-7,10,12H2,1-3H3 |
| InChIKey | SSINERJAWSIKGJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |