C25H26O7 — CID 78236561
[3-(3,4-dimethoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3-methoxybenzoate (PubChem CID 78236561) has the molecular formula C25H26O7 and a molecular weight of 438.48 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3-methoxybenzoate.
| Compound Name | [3-(3,4-dimethoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 78236561 |
| Molecular Formula | C25H26O7 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OC2CCC3C(=O)C(c4ccc(OC)c(OC)c4)=COC3C2)c1 |
| InChI | InChI=1S/C25H26O7/c1-28-17-6-4-5-16(11-17)25(27)32-18-8-9-19-22(13-18)31-14-20(24(19)26)15-7-10-21(29-2)23(12-15)30-3/h4-7,10-12,14,18-19,22H,8-9,13H2,1-3H3 |
| InChIKey | ZKJZQJKKJJAESI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |