C24H22O7 — CID 78236613
[3-(4-methoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 1,3-benzodioxole-5-carboxylate (PubChem CID 78236613) has the molecular formula C24H22O7 and a molecular weight of 422.43 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [3-(4-methoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 78236613 |
| Molecular Formula | C24H22O7 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [3-(4-methoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 1,3-benzodioxole-5-carboxylate |
| SMILES | COc1ccc(C2=COC3CC(OC(=O)c4ccc5c(c4)OCO5)CCC3C2=O)cc1 |
| InChI | InChI=1S/C24H22O7/c1-27-16-5-2-14(3-6-16)19-12-28-21-11-17(7-8-18(21)23(19)25)31-24(26)15-4-9-20-22(10-15)30-13-29-20/h2-6,9-10,12,17-18,21H,7-8,11,13H2,1H3 |
| InChIKey | IRCBOAYWUSMLLT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |