C24H22Cl2O5 — CID 78237885
[3-(4-ethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,4-dichlorobenzoate (PubChem CID 78237885) has the molecular formula C24H22Cl2O5 and a molecular weight of 461.34 g/mol. Its IUPAC name is [3-(4-ethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,4-dichlorobenzoate.
| Compound Name | [3-(4-ethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 78237885 |
| Molecular Formula | C24H22Cl2O5 |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | [3-(4-ethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,4-dichlorobenzoate |
| SMILES | CCc1ccc(OC2=COC3CC(OC(=O)c4ccc(Cl)c(Cl)c4)CCC3C2=O)cc1 |
| InChI | InChI=1S/C24H22Cl2O5/c1-2-14-3-6-16(7-4-14)30-22-13-29-21-12-17(8-9-18(21)23(22)27)31-24(28)15-5-10-19(25)20(26)11-15/h3-7,10-11,13,17-18,21H,2,8-9,12H2,1H3 |
| InChIKey | DUCOPBGRLRSCLB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |