C20H22O6 — CID 78237959
[3-(2-methoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] prop-2-enyl carbonate (PubChem CID 78237959) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is [3-(2-methoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] prop-2-enyl carbonate.
| Compound Name | [3-(2-methoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] prop-2-enyl carbonate |
|---|---|
| PubChem CID | 78237959 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [3-(2-methoxyphenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC1CCC2C(=O)C(c3ccccc3OC)=COC2C1 |
| InChI | InChI=1S/C20H22O6/c1-3-10-24-20(22)26-13-8-9-15-18(11-13)25-12-16(19(15)21)14-6-4-5-7-17(14)23-2/h3-7,12-13,15,18H,1,8-11H2,2H3 |
| InChIKey | YRRMBOATHUDAEG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|