C19H23NO6 — CID 78236608
[3-(2-methoxyphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 78236608) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is [3-(2-methoxyphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [3-(2-methoxyphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 78236608 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | [3-(2-methoxyphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | COc1ccccc1OC1=COC2CC(OC(=O)N(C)C)CCC2C1=O |
| InChI | InChI=1S/C19H23NO6/c1-20(2)19(22)25-12-8-9-13-16(10-12)24-11-17(18(13)21)26-15-7-5-4-6-14(15)23-3/h4-7,11-13,16H,8-10H2,1-3H3 |
| InChIKey | YOZILDRTPISDOJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |