C24H26N2O4 — CID 73402115
3-(2-methoxyphenyl)-9-(pyridin-2-ylmethyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one (PubChem CID 73402115) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-9-(pyridin-2-ylmethyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one.
| Compound Name | 3-(2-methoxyphenyl)-9-(pyridin-2-ylmethyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 73402115 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 3-(2-methoxyphenyl)-9-(pyridin-2-ylmethyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
| SMILES | COc1ccccc1C1=COC2C(CCC3OCN(Cc4ccccn4)CC32)C1=O |
| InChI | InChI=1S/C24H26N2O4/c1-28-21-8-3-2-7-17(21)20-14-29-24-18(23(20)27)9-10-22-19(24)13-26(15-30-22)12-16-6-4-5-11-25-16/h2-8,11,14,18-19,22,24H,9-10,12-13,15H2,1H3 |
| InChIKey | LCWAWRNOOGZQIO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |