C17H26N2O4S — CID 7822707
[2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7822707) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7822707 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=O)COC(=O)[C@@H]1CS[C@@]2(C)CCC(=O)N12 |
| InChI | InChI=1S/C17H26N2O4S/c1-11-5-3-4-6-12(11)18-14(20)9-23-16(22)13-10-24-17(2)8-7-15(21)19(13)17/h11-13H,3-10H2,1-2H3,(H,18,20)/t11-,12-,13-,17-/m0/s1 |
| InChIKey | IRTXPDQBLQMSAU-MRHIQRDNSA-N |
| XLogP | 1.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |