C16H25N5O2 — CID 78227692
8-(3,5-dimethylpiperidin-1-yl)-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione (PubChem CID 78227692) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 8-(3,5-dimethylpiperidin-1-yl)-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-(3,5-dimethylpiperidin-1-yl)-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78227692 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 8-(3,5-dimethylpiperidin-1-yl)-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCN1C(N2CC(C)CC(C)C2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C16H25N5O2/c1-5-6-21-12-13(19(4)16(23)18-14(12)22)17-15(21)20-8-10(2)7-11(3)9-20/h5,10-13H,1,6-9H2,2-4H3,(H,18,22,23) |
| InChIKey | RBROZPAJVKQGQI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|