C18H18N2O4S — CID 7822941
(5-phenyl-1,3-oxazol-2-yl)methyl (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7822941) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7822941 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | C[C@@]12CCC(=O)N1[C@H](C(=O)OCc1ncc(-c3ccccc3)o1)CS2 |
| InChI | InChI=1S/C18H18N2O4S/c1-18-8-7-16(21)20(18)13(11-25-18)17(22)23-10-15-19-9-14(24-15)12-5-3-2-4-6-12/h2-6,9,13H,7-8,10-11H2,1H3/t13-,18+/m0/s1 |
| InChIKey | BQJRQORSNKXCQT-SCLBCKFNSA-N |
| XLogP | 2.84 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |